![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[DIR]](/icons/folder.gif) | 2 Unlimited/ | 2025-01-06 20:36 | - | |
| 3 Doors Down/ | 2025-04-01 04:13 | - | |
| 3LW/ | 2025-04-01 04:13 | - | |
| 8 Ball/ | 2025-04-01 04:13 | - | |
| 10,000 Maniacs/ | 2025-01-06 20:36 | - | |
| 10 Years/ | 2025-04-01 04:13 | - | |
| 30 Seconds to Mars/ | 2025-04-01 04:13 | - | |
| 38 Special/ | 2025-01-06 20:36 | - | |
| 50 Cent/ | 2025-04-01 04:13 | - | |
| 69 Boyz/ | 2025-01-06 20:36 | - | |
| 112/ | 2025-04-01 04:13 | - | |
| 311/ | 2025-04-01 04:13 | - | |
| 504 Boyz/ | 2025-04-01 04:13 | - | |
| 702/ | 2025-01-06 20:31 | - | |
| AC-DC/ | 2025-04-01 04:13 | - | |
| AFI/ | 2025-04-01 04:13 | - | |
| A New Found Glory/ | 2025-04-01 04:13 | - | |
| A Perfect Circle/ | 2025-04-01 04:13 | - | |
| A Simple Plan/ | 2025-01-06 20:31 | - | |
| Aaliyah/ | 2025-01-06 20:31 | - | |
| Aaron Lewis/ | 2025-04-01 04:13 | - | |
| Aaron Neville/ | 2025-04-01 04:13 | - | |
| Ace/ | 2025-04-01 04:13 | - | |
| Ace of Base/ | 2025-01-06 20:31 | - | |
| Adam Sandler/ | 2025-01-06 20:31 | - | |
| Adema/ | 2025-01-06 20:31 | - | |
| Aerosmith/ | 2025-04-01 04:13 | - | |
| Afro Man/ | 2025-04-01 04:13 | - | |
| Agallah/ | 2025-04-01 04:13 | - | |
| Ah-Ha/ | 2025-01-06 20:32 | - | |
| Air Supply/ | 2025-01-06 20:32 | - | |
| Akon/ | 2025-01-06 20:32 | - | |
| Al Green/ | 2025-01-06 20:32 | - | |
| Alanis Morrissette/ | 2025-04-01 04:13 | - | |
| Alannah Miles/ | 2025-01-06 20:32 | - | |
| Ali/ | 2025-04-01 04:13 | - | |
| Alice Cooper/ | 2025-01-06 20:32 | - | |
| Alice in Chains/ | 2025-04-01 04:13 | - | |
| Alicia Keys/ | 2025-01-06 20:32 | - | |
| Alien Ant Farm/ | 2025-04-01 04:13 | - | |
| Alkaline Trio/ | 2025-04-01 04:13 | - | |
| All-American Rejects/ | 2025-04-01 04:13 | - | |
| Allman Brothers Band, The/ | 2025-04-01 04:13 | - | |
| Alter Bridge/ | 2025-01-06 20:32 | - | |
| Ambrosia/ | 2025-04-01 04:12 | - | |
| America/ | 2025-04-01 04:13 | - | |
| American Football/ | 2025-01-06 20:32 | - | |
| American Hi-Fi/ | 2025-04-01 04:13 | - | |
| Amy Grant/ | 2025-01-06 20:32 | - | |
| Anarchy Club/ | 2025-01-06 20:32 | - | |
| Animals/ | 2025-01-06 20:32 | - | |
| Annie Lennox/ | 2025-01-06 20:32 | - | |
| Anternicy/ | 2025-01-06 20:32 | - | |
| Anthrax/ | 2025-01-06 20:32 | - | |
| Aphex Twin/ | 2025-01-06 20:32 | - | |
| Apocalyptica/ | 2025-04-01 04:13 | - | |
| Apollo 440/ | 2025-04-01 04:13 | - | |
| Argent/ | 2025-01-06 20:32 | - | |
| Ashanti/ | 2025-04-01 04:13 | - | |
| Asia/ | 2025-04-01 04:13 | - | |
| Ataris, The/ | 2025-04-01 04:13 | - | |
| Atmosphere/ | 2025-04-01 04:13 | - | |
| Atreyu/ | 2025-01-06 20:32 | - | |
| Audioslave/ | 2025-04-01 04:13 | - | |
| Audiovent/ | 2025-01-06 20:32 | - | |
| Autograph/ | 2025-01-06 20:32 | - | |
| Avenged Sevenfold/ | 2025-04-01 04:13 | - | |
| Avril Lavigne/ | 2025-04-01 04:13 | - | |
| B.G/ | 2025-04-01 04:13 | - | |
| B2K/ | 2025-01-06 20:32 | - | |
| B52's/ | 2025-01-06 20:32 | - | |
| BG/ | 2025-01-06 20:32 | - | |
| Baby/ | 2025-04-01 04:13 | - | |
| Baby Bash/ | 2025-04-03 03:32 | - | |
| Bachelor Number One/ | 2025-01-06 20:32 | - | |
| Bachman-Turner Overdrive/ | 2025-04-01 04:13 | - | |
| Bad Company/ | 2025-04-01 04:13 | - | |
| Bad English/ | 2025-01-06 20:32 | - | |
| Bad Religion/ | 2025-01-06 20:32 | - | |
| Badfinger/ | 2025-04-01 04:13 | - | |
| Balitmora/ | 2025-01-06 20:32 | - | |
| Band, The/ | 2025-01-06 20:32 | - | |
| Bangles, The/ | 2025-01-06 20:32 | - | |
| Barenaked Ladies/ | 2025-01-06 20:32 | - | |
| Basement Jaxx/ | 2025-04-01 04:13 | - | |
| Beach Boys/ | 2025-01-06 20:32 | - | |
| Beanie Seigel/ | 2025-01-06 20:32 | - | |
| Beastie Boys/ | 2025-04-01 04:13 | - | |
| Beatles, The/ | 2025-04-01 04:13 | - | |
| Beck/ | 2025-04-01 04:13 | - | |
| Bedo/ | 2025-01-06 20:32 | - | |
| Bee Gees/ | 2025-01-06 20:32 | - | |
| Belinda Carlisle/ | 2025-01-06 20:32 | - | |
| Bell Biv Devoe/ | 2025-01-06 20:32 | - | |
| Ben Folds (Five)/ | 2025-04-01 04:13 | - | |
| Ben Harper/ | 2025-01-06 20:32 | - | |
| Beta Band/ | 2025-04-01 04:13 | - | |
| Bette Midler/ | 2025-01-06 20:32 | - | |
| Better Than Ezra/ | 2025-04-01 04:13 | - | |
| Beyonce Knowles/ | 2025-01-06 20:32 | - | |
| Big Audio Dynamite/ | 2025-04-01 04:13 | - | |
| Big Head Todd and the Monsters/ | 2025-01-06 20:32 | - | |
| Big Mountain/ | 2025-01-06 20:32 | - | |
| Big Pun/ | 2025-04-01 04:13 | - | |
| Big Tymers/ | 2025-04-01 04:13 | - | |
| Bill Medley and Jennifer Warnes/ | 2025-01-06 20:32 | - | |
| Bill Withers/ | 2025-04-01 04:13 | - | |
| Billie Myers/ | 2025-01-06 20:32 | - | |
| Billy Idol/ | 2025-01-06 20:32 | - | |
| Billy Joel/ | 2025-04-01 04:13 | - | |
| Billy Ocean/ | 2025-01-06 20:32 | - | |
| Billy Squire/ | 2025-01-06 20:32 | - | |
| Billy Talent/ | 2025-04-01 04:13 | - | |
| Biz Markie/ | 2025-01-06 20:32 | - | |
| Bizzy Bone/ | 2025-04-01 04:13 | - | |
| Black Box/ | 2025-01-06 20:32 | - | |
| Black Crows, The/ | 2025-01-06 20:32 | - | |
| Black Eyed Peas/ | 2025-04-01 04:13 | - | |
| Black Haze/ | 2025-01-06 20:32 | - | |
| Black Rob/ | 2025-01-06 20:32 | - | |
| Black Sabbath/ | 2025-04-01 04:13 | - | |
| Black Tide/ | 2025-01-06 20:32 | - | |
| Blackstreet/ | 2025-01-06 20:32 | - | |
| Blessid Union of Souls/ | 2025-01-06 20:32 | - | |
| Blind Melon/ | 2025-01-06 20:32 | - | |
| Blink 182/ | 2025-04-01 04:13 | - | |
| Bloc Party/ | 2025-04-01 04:13 | - | |
| Blondie/ | 2025-01-06 20:32 | - | |
| Bloodhound Gang, The/ | 2025-04-03 03:32 | - | |
| Blu Cantrell/ | 2025-01-06 20:32 | - | |
| Blue Oyster Cult/ | 2025-04-01 04:13 | - | |
| Blues Travelor/ | 2025-01-06 20:32 | - | |
| Blur/ | 2025-01-06 20:32 | - | |
| Bob Dylan/ | 2025-04-01 04:13 | - | |
| Bob Marley/ | 2025-04-01 04:13 | - | |
| Bob Seger/ | 2025-01-06 20:32 | - | |
| Bobaflex/ | 2025-04-01 04:13 | - | |
| Bobby Brown/ | 2025-01-06 20:32 | - | |
| Bodeans/ | 2025-01-06 20:32 | - | |
| Body Headbangers/ | 2025-01-06 20:32 | - | |
| Bon Jovi/ | 2025-04-01 04:13 | - | |
| Bone Thugs N Harmony/ | 2025-04-01 04:13 | - | |
| Bonecrusher/ | 2025-01-06 20:32 | - | |
| Bonnie Tyler/ | 2025-01-06 20:32 | - | |
| Booker T & The MGs/ | 2025-04-01 04:13 | - | |
| Boston/ | 2025-04-01 04:13 | - | |
| Bowling For Soup/ | 2025-01-06 20:32 | - | |
| Boys II Men/ | 2025-04-01 04:13 | - | |
| Boyz in the Hood/ | 2025-01-06 20:32 | - | |
| Brand New/ | 2025-04-01 04:13 | - | |
| Brandy/ | 2025-01-06 20:32 | - | |
| Breaking Benjamin/ | 2025-04-01 04:13 | - | |
| Breeders, The/ | 2025-01-06 20:32 | - | |
| Bright Eyes/ | 2025-04-01 04:13 | - | |
| Britney Spears/ | 2025-01-06 20:32 | - | |
| Brother Ali/ | 2025-04-01 04:13 | - | |
| Brownsville Station/ | 2025-01-06 20:32 | - | |
| Bruce Springsteen/ | 2025-04-01 04:13 | - | |
| Bryan Adams/ | 2025-04-03 03:32 | - | |
| Bubba Sparxxx/ | 2025-01-06 20:32 | - | |
| Buckcherry/ | 2025-01-06 20:32 | - | |
| Buckethead/ | 2025-01-06 20:32 | - | |
| Buffalo Springfield/ | 2025-01-06 20:32 | - | |
| Buggles, The/ | 2025-01-06 20:32 | - | |
| Bun B/ | 2025-04-01 04:13 | - | |
| Bush/ | 2025-04-01 04:13 | - | |
| Busta Rhymes/ | 2025-04-01 04:13 | - | |
| Butthole Surfers/ | 2025-01-06 20:32 | - | |
| Byrds, The/ | 2025-01-06 20:32 | - | |
| CCR/ | 2025-04-01 04:13 | - | |
| CKY/ | 2025-01-06 20:32 | - | |
| Caddilac Tah/ | 2025-01-06 20:32 | - | |
| Cake/ | 2025-04-01 04:13 | - | |
| Calling, The/ | 2025-04-01 04:13 | - | |
| Cam'ron/ | 2025-04-01 04:13 | - | |
| Cameo/ | 2025-01-06 20:32 | - | |
| Candlebox/ | 2025-04-01 04:13 | - | |
| Cardigans, The/ | 2025-04-01 04:13 | - | |
| Carl Douglas/ | 2025-01-06 20:32 | - | |
| Carlos Santana/ | 2025-04-01 04:13 | - | |
| Cars, The/ | 2025-04-01 04:13 | - | |
| Catch22/ | 2025-04-01 04:13 | - | |
| Cause and Effect/ | 2025-04-01 04:13 | - | |
| Cee-Lo/ | 2025-01-06 20:32 | - | |
| Chamillionaire/ | 2025-04-01 04:13 | - | |
| Chantal Kreviazuk/ | 2025-01-06 20:32 | - | |
| Charlie Daniels Band/ | 2025-01-06 20:32 | - | |
| Cheap Trick/ | 2025-04-01 04:13 | - | |
| Cheech and Chong/ | 2025-01-06 20:32 | - | |
| Chemical Brothers/ | 2025-01-06 20:32 | - | |
| Cher/ | 2025-04-01 04:13 | - | |
| Cherry Poppin' Daddies/ | 2025-04-01 04:13 | - | |
| Chevelle/ | 2025-04-01 04:13 | - | |
| Chicago/ | 2025-04-01 04:13 | - | |
| Chimaira/ | 2025-04-01 04:13 | - | |
| Chingy/ | 2025-04-01 04:13 | - | |
| Choppa/ | 2025-01-06 20:32 | - | |
| Chopper/ | 2025-01-06 20:32 | - | |
| Chris Brown/ | 2025-01-06 20:32 | - | |
| Chris Cornell/ | 2025-04-01 04:13 | - | |
| Chris Daughtry/ | 2025-04-03 03:32 | - | |
| Chris Deburgh/ | 2025-01-06 20:32 | - | |
| Chris Rock/ | 2025-01-06 20:32 | - | |
| Christina Aguilera/ | 2025-04-01 04:13 | - | |
| Christina Millian/ | 2025-04-01 04:13 | - | |
| Chuck Berry/ | 2025-01-06 20:32 | - | |
| Chuck Tease/ | 2025-01-06 20:32 | - | |
| ChumbaWumba/ | 2025-01-06 20:32 | - | |
| Ciara/ | 2025-01-06 20:32 | - | |
| Cinderella/ | 2025-04-01 04:13 | - | |
| Citizen Cope/ | 2025-04-01 04:13 | - | |
| Citizen King/ | 2025-01-06 20:32 | - | |
| Clash, The/ | 2025-04-01 04:13 | - | |
| Climax Blues Band/ | 2025-01-06 20:32 | - | |
| Clipse/ | 2025-01-06 20:32 | - | |
| Clutch/ | 2025-01-06 20:32 | - | |
| Cognito/ | 2025-04-01 04:13 | - | |
| Coheed and Cambria/ | 2025-04-01 04:13 | - | |
| Cold/ | 2025-04-01 04:13 | - | |
| Coldplay/ | 2025-04-01 04:13 | - | |
| Collective Soul/ | 2025-04-01 04:13 | - | |
| Commodores, The/ | 2025-04-01 04:13 | - | |
| Common/ | 2025-01-06 20:32 | - | |
| Coolio/ | 2025-04-01 04:13 | - | |
| Cosmonauti/ | 2025-01-06 20:32 | - | |
| Counting Crows/ | 2025-04-01 04:13 | - | |
| Country/ | 2025-04-01 04:13 | - | |
| Course of Nature/ | 2025-01-06 20:32 | - | |
| Cowboy Mouth/ | 2025-01-06 20:32 | - | |
| Coyote Ulgy Soundtrack/ | 2025-01-06 20:32 | - | |
| Cracker/ | 2025-01-06 20:32 | - | |
| Craig David/ | 2025-04-01 04:13 | - | |
| Cranberries, The/ | 2025-01-06 20:32 | - | |
| Crash Test Dummies/ | 2025-01-06 20:32 | - | |
| Crazytown/ | 2025-01-06 20:32 | - | |
| Cream/ | 2025-04-01 04:13 | - | |
| Creed/ | 2025-04-01 04:13 | - | |
| Crosby, Stills, Nash, and Young/ | 2025-01-06 20:32 | - | |
| Crossfade/ | 2025-04-01 04:13 | - | |
| Crowded House/ | 2025-01-06 20:32 | - | |
| Crystal Method, The/ | 2025-04-01 04:13 | - | |
| Cult, The/ | 2025-01-06 20:32 | - | |
| Culture Club/ | 2025-01-06 20:32 | - | |
| Cure, The/ | 2025-01-06 20:32 | - | |
| Cutting Crew/ | 2025-01-06 20:32 | - | |
| Cyndi Lauper/ | 2025-01-06 20:32 | - | |
| Cypress Hill/ | 2025-04-01 04:13 | - | |
| D12/ | 2025-04-01 04:13 | - | |
| DHT/ | 2025-01-06 20:33 | - | |
| DMX/ | 2025-04-01 04:13 | - | |
| Daiquiri/ | 2025-01-06 20:33 | - | |
| Damageplan/ | 2025-04-01 04:13 | - | |
| Damn Yankees/ | 2025-01-06 20:33 | - | |
| Daniel Lioneye/ | 2025-01-06 20:33 | - | |
| Daniel Powter/ | 2025-01-06 20:33 | - | |
| Danzig/ | 2025-01-06 20:33 | - | |
| Darkness, The/ | 2025-01-06 20:33 | - | |
| Darude/ | 2025-01-06 20:33 | - | |
| Daryl Hall/ | 2025-01-16 15:13 | - | |
| Dashboard Confessional/ | 2025-04-01 04:13 | - | |
| Dave Matthews (Band)/ | 2025-04-01 04:13 | - | |
| Dave Navarro/ | 2025-04-03 03:32 | - | |
| David Banner/ | 2025-04-01 04:13 | - | |
| David Bowie/ | 2025-04-01 04:13 | - | |
| David Essex/ | 2025-01-06 20:33 | - | |
| David Gray/ | 2025-04-01 04:13 | - | |
| David Lee Roth/ | 2025-01-06 20:33 | - | |
| Daylights, The/ | 2025-04-01 04:13 | - | |
| Days of the New/ | 2025-01-06 20:33 | - | |
| Dead Milkmen/ | 2025-01-06 20:33 | - | |
| Dead Prez/ | 2025-04-01 04:13 | - | |
| Deadeye Dick/ | 2025-04-01 04:13 | - | |
| Dead or Alive/ | 2025-01-06 20:33 | - | |
| Deep Blue Something/ | 2025-01-06 20:33 | - | |
| Deep Purple/ | 2025-04-01 04:13 | - | |
| Def Leppard/ | 2025-04-01 04:13 | - | |
| Def Squad/ | 2025-01-06 20:33 | - | |
| Default/ | 2025-01-06 20:33 | - | |
| Deftones/ | 2025-04-01 04:13 | - | |
| Dem Franchise Boyz/ | 2025-04-01 04:13 | - | |
| Denise Williams/ | 2025-04-01 04:13 | - | |
| Destiny's Child/ | 2025-04-01 04:13 | - | |
| Destrophy/ | 2025-01-06 20:33 | - | |
| Dethklok/ | 2025-04-01 04:13 | - | |
| Dexter Freebish/ | 2025-04-01 04:13 | - | |
| Dialated Peoples/ | 2025-01-06 20:33 | - | |
| Diana Ross and the Supremes/ | 2025-01-06 20:33 | - | |
| Dinosaur Jr/ | 2025-04-01 04:13 | - | |
| Dionne Warwick/ | 2025-01-06 20:33 | - | |
| Dire Straits/ | 2025-01-06 20:33 | - | |
| Dirty/ | 2025-04-01 04:13 | - | |
| Dirty Vegas/ | 2025-01-06 20:33 | - | |
| Dishwalla/ | 2025-04-01 04:13 | - | |
| Dispatch/ | 2025-01-06 20:33 | - | |
| Disturbed/ | 2025-04-01 04:13 | - | |
| Divinyls/ | 2025-01-06 20:33 | - | |
| Dobie Gray/ | 2025-01-06 20:33 | - | |
| Dogs Eye View/ | 2025-01-06 20:33 | - | |
| Don Mclean/ | 2025-01-06 20:33 | - | |
| Donnas, The/ | 2025-04-01 04:13 | - | |
| Doobie Brothers/ | 2025-01-06 20:33 | - | |
| Do or Die/ | 2025-04-01 04:13 | - | |
| Doors, The/ | 2025-04-01 04:13 | - | |
| Dope/ | 2025-01-06 20:33 | - | |
| Dr. Dre/ | 2025-04-01 04:13 | - | |
| Dragonforce/ | 2025-04-01 04:13 | - | |
| Drake/ | 2025-01-06 20:33 | - | |
| Drastek/ | 2025-01-06 20:33 | - | |
| Dream/ | 2025-04-01 04:13 | - | |
| Dredg/ | 2025-04-01 04:13 | - | |
| Drist/ | 2025-01-06 20:33 | - | |
| Dropkick Murphy's/ | 2025-04-01 04:13 | - | |
| Drowning Pool/ | 2025-01-06 20:33 | - | |
| Dru Hill/ | 2025-01-06 20:33 | - | |
| Duke Daniels/ | 2025-01-06 20:33 | - | |
| Dumb and Dumber Soundtrack/ | 2025-04-01 04:13 | - | |
| Duncan Shiek/ | 2025-01-06 20:33 | - | |
| Duran Duran/ | 2025-04-01 04:13 | - | |
| Dust Brothers/ | 2025-01-06 20:33 | - | |
| Dynamite Hack/ | 2025-04-01 04:13 | - | |
| Dynospectrum, The/ | 2025-02-05 02:18 | - | |
| E 40/ | 2025-01-06 20:33 | - | |
| EMF/ | 2025-01-06 20:33 | - | |
| Eagle Eye Cherry/ | 2025-01-06 20:33 | - | |
| Eagles, The/ | 2025-04-01 04:13 | - | |
| Eamon/ | 2025-01-06 20:33 | - | |
| Earshot/ | 2025-04-01 04:13 | - | |
| Earth Wind and Fire/ | 2025-04-01 04:13 | - | |
| Echo and the Bunnymen/ | 2025-04-01 04:13 | - | |
| Eddie Money/ | 2025-01-06 20:33 | - | |
| Eddie Rabbit/ | 2025-01-06 20:33 | - | |
| Eddie Vedder/ | 2025-04-01 04:13 | - | |
| Edgar Winter Group/ | 2025-01-06 20:33 | - | |
| Edie Brickell/ | 2025-01-06 20:33 | - | |
| Edwin McCain/ | 2025-01-06 20:33 | - | |
| Edwin Starr/ | 2025-01-06 20:33 | - | |
| Eiffel 65/ | 2025-04-01 04:13 | - | |
| Electric Light Orchestra/ | 2025-04-01 04:13 | - | |
| Elliott Smith/ | 2025-04-01 04:13 | - | |
| Elton John/ | 2025-01-06 20:33 | - | |
| Elvin Bishop/ | 2025-04-01 04:13 | - | |
| Elvis Presley/ | 2025-01-06 20:33 | - | |
| Eminem/ | 2025-04-01 04:13 | - | |
| En Vogue/ | 2025-01-06 20:33 | - | |
| Eric Carmen/ | 2025-01-06 20:33 | - | |
| Eric Clapton/ | 2025-04-01 04:13 | - | |
| Eric Prydz/ | 2025-01-06 20:33 | - | |
| Escape Club/ | 2025-04-01 04:13 | - | |
| Europe/ | 2025-01-06 20:33 | - | |
| Eurythmics/ | 2025-01-06 20:33 | - | |
| Evan and Jaron/ | 2025-04-01 04:13 | - | |
| Evanescence/ | 2025-04-01 04:13 | - | |
| Eve/ | 2025-01-06 20:33 | - | |
| Eve 6/ | 2025-04-01 04:13 | - | |
| Everclear/ | 2025-04-01 04:13 | - | |
| Everlast/ | 2025-04-01 04:13 | - | |
| Exies, The/ | 2025-04-01 04:13 | - | |
| Expose/ | 2025-01-06 20:33 | - | |
| Extreme/ | 2025-01-06 20:33 | - | |
| Fabulous/ | 2025-01-06 20:33 | - | |
| Faith No More/ | 2025-01-06 20:33 | - | |
| Fall Out Boy/ | 2025-04-01 04:13 | - | |
| Far/ | 2025-01-06 20:33 | - | |
| Fastball/ | 2025-04-01 04:13 | - | |
| Fat Joe/ | 2025-04-01 04:13 | - | |
| Fatboy Slim/ | 2025-01-06 20:33 | - | |
| Fear Factory/ | 2025-04-01 04:13 | - | |
| Felt3/ | 2025-04-01 04:13 | - | |
| Filter/ | 2025-01-06 20:33 | - | |
| Finding Forrester Soundtrack/ | 2025-01-06 20:33 | - | |
| Fine Young Cannibals/ | 2025-01-06 20:33 | - | |
| Finger Eleven/ | 2025-04-01 04:13 | - | |
| Fiona Apple/ | 2025-01-06 20:33 | - | |
| Firehouse/ | 2025-01-06 20:33 | - | |
| Fischerspooner/ | 2025-04-01 04:13 | - | |
| Fishbone/ | 2025-04-03 03:32 | - | |
| Five Man Electrical Band/ | 2025-01-06 20:33 | - | |
| Five for Fighting/ | 2025-04-01 04:13 | - | |
| Flaming Lips, The/ | 2025-04-01 04:13 | - | |
| Flaw/ | 2025-04-01 04:13 | - | |
| Fleetwood Mac/ | 2025-04-03 03:32 | - | |
| Flyleaf/ | 2025-04-01 04:13 | - | |
| Foghat/ | 2025-01-06 20:33 | - | |
| Foo Fighters/ | 2025-04-01 04:13 | - | |
| Foreigner/ | 2025-04-01 04:13 | - | |
| Fountains of Wayne/ | 2025-04-01 04:13 | - | |
| Four Non Blondes/ | 2025-01-06 20:33 | - | |
| Four Tops, The/ | 2025-01-06 20:33 | - | |
| Frankie Valley and the Four Seasons/ | 2025-04-03 03:32 | - | |
| Franz Ferdinand/ | 2025-01-06 20:33 | - | |
| Freaknasty/ | 2025-01-06 20:33 | - | |
| Freedy Johnston/ | 2025-04-01 04:13 | - | |
| Frida Snell/ | 2025-01-06 20:33 | - | |
| Friday Soundtrack/ | 2025-01-06 20:33 | - | |
| From Autumn to Ashes/ | 2025-01-06 20:33 | - | |
| Fuel/ | 2025-01-06 20:33 | - | |
| Fugees, The/ | 2025-04-01 04:13 | - | |
| Future Leaders of the World/ | 2025-01-06 20:33 | - | |
| G Unit/ | 2025-04-01 04:13 | - | |
| Game, The/ | 2025-04-01 04:13 | - | |
| Garbage/ | 2025-04-01 04:13 | - | |
| Garden State Soundtrack/ | 2025-04-01 04:13 | - | |
| Gary Glitter/ | 2025-01-06 20:33 | - | |
| Gary Jules/ | 2025-01-06 20:33 | - | |
| Gary Numan/ | 2025-01-06 20:33 | - | |
| Gary Puckett and the Union Gap/ | 2025-01-06 20:33 | - | |
| Gary Wright/ | 2025-01-06 20:33 | - | |
| Gavin DeGraw/ | 2025-04-01 04:13 | - | |
| Genesis/ | 2025-04-01 04:13 | - | |
| George Benson/ | 2025-01-06 20:33 | - | |
| George Harrison/ | 2025-04-01 04:13 | - | |
| George Michael/ | 2025-01-06 20:33 | - | |
| George Thorogood/ | 2025-04-01 04:13 | - | |
| Gerry Rafferty/ | 2025-04-01 04:13 | - | |
| Geto Boys/ | 2025-04-03 03:32 | - | |
| Ghost/ | 2025-01-23 15:55 | - | |
| Gin Blossoms/ | 2025-04-01 04:13 | - | |
| Ginuwine/ | 2025-04-01 04:13 | - | |
| Gipsy Kings/ | 2025-04-01 04:13 | - | |
| Glenn Frey/ | 2025-01-06 20:33 | - | |
| Gnarls Barkley/ | 2025-01-06 20:33 | - | |
| Go-Go's, The/ | 2025-01-06 20:33 | - | |
| Gob/ | 2025-01-06 20:33 | - | |
| Godsmack/ | 2025-04-01 04:13 | - | |
| Golden Earring/ | 2025-04-01 04:13 | - | |
| Goldfinger/ | 2025-04-03 03:32 | - | |
| Goldfrapp/ | 2025-04-01 04:13 | - | |
| Gone in 60 Seconds Soundtrack/ | 2025-01-06 20:33 | - | |
| Goo Goo Dolls/ | 2025-04-01 04:13 | - | |
| Good Charlotte/ | 2025-01-06 20:33 | - | |
| Good shit/ | 2025-01-06 20:33 | - | |
| Gorillaz/ | 2025-04-01 04:13 | - | |
| Government Mule/ | 2025-01-06 20:33 | - | |
| Grand Funk Railroad/ | 2025-04-01 04:13 | - | |
| Grand Master Flash/ | 2025-01-06 20:33 | - | |
| Grand Theft Auto III/ | 2025-01-06 20:33 | - | |
| Grant Lee Buffalo/ | 2025-01-06 20:33 | - | |
| Grateful Dead/ | 2025-04-01 04:13 | - | |
| Gravity Kills/ | 2025-01-06 20:33 | - | |
| Great White/ | 2025-01-06 20:33 | - | |
| Green Day/ | 2025-04-01 04:13 | - | |
| Greenskeepers/ | 2025-01-06 20:33 | - | |
| Guess Who, The/ | 2025-01-06 20:33 | - | |
| Guns 'n Roses/ | 2025-04-01 04:13 | - | |
| Guster/ | 2025-01-06 20:33 | - | |
| Gwen Stefani/ | 2025-04-01 04:13 | - | |
| HIM/ | 2025-04-01 04:13 | - | |
| Haddaway/ | 2025-01-06 20:33 | - | |
| Hall and Oates/ | 2025-04-01 04:13 | - | |
| Harry Chapin/ | 2025-01-06 20:33 | - | |
| Harvey Danger/ | 2025-04-01 04:13 | - | |
| Heart/ | 2025-04-01 04:13 | - | |
| Helmet/ | 2025-01-06 20:33 | - | |
| Henry Rollins Band/ | 2025-01-06 20:33 | - | |
| Herbie Hancock/ | 2025-04-01 04:13 | - | |
| Hi Tek 3/ | 2025-01-06 20:33 | - | |
| Hinder/ | 2025-04-01 04:13 | - | |
| Hippos, The/ | 2025-04-01 04:13 | - | |
| Hog/ | 2025-04-01 04:13 | - | |
| Hole/ | 2025-04-01 04:13 | - | |
| Hoobastank/ | 2025-04-01 04:13 | - | |
| Hootie and the Blowfish/ | 2025-04-01 04:13 | - | |
| House of Pain/ | 2025-01-06 20:33 | - | |
| Houston/ | 2025-01-06 20:33 | - | |
| Hues Corporation/ | 2025-01-06 20:33 | - | |
| Huey Lewis and the News/ | 2025-01-06 20:33 | - | |
| Human League/ | 2025-01-06 20:33 | - | |
| Hurt/ | 2025-04-01 04:13 | - | |
| INXS/ | 2025-04-01 04:13 | - | |
| Ice Cube/ | 2025-04-01 04:13 | - | |
| Iconz/ | 2025-01-06 20:33 | - | |
| Il Nino/ | 2025-04-01 04:13 | - | |
| Incubus/ | 2025-04-01 04:13 | - | |
| Index Case/ | 2025-04-01 04:13 | - | |
| Injected/ | 2025-04-01 04:13 | - | |
| Inner Circle/ | 2025-01-06 20:33 | - | |
| Insane Clown Posse/ | 2025-04-01 04:13 | - | |
| Iron Maiden/ | 2025-01-06 20:33 | - | |
| J-Kwon/ | 2025-01-06 20:33 | - | |
| J. Geils Band/ | 2025-01-06 20:33 | - | |
| J.Lo/ | 2025-04-01 04:13 | - | |
| JT Money/ | 2025-01-06 20:33 | - | |
| Ja Rule/ | 2025-04-01 04:13 | - | |
| Jack Johnson/ | 2025-04-01 04:13 | - | |
| Jackie Wilson/ | 2025-01-06 20:33 | - | |
| Jackson 5/ | 2025-01-06 20:33 | - | |
| Jackson Browne/ | 2025-01-06 20:33 | - | |
| Jackyl/ | 2025-04-03 03:32 | - | |
| Jagged Edge/ | 2025-01-06 20:33 | - | |
| James/ | 2025-04-01 04:13 | - | |
| James Blunt/ | 2025-01-06 20:33 | - | |
| James Brown/ | 2025-01-06 20:33 | - | |
| James Taylor/ | 2025-04-01 04:13 | - | |
| Jamie Foxx/ | 2025-04-01 04:13 | - | |
| Jamiroquai/ | 2025-04-01 04:13 | - | |
| Jane's Addiction/ | 2025-04-01 04:13 | - | |
| Janis Joplin/ | 2025-01-06 20:33 | - | |
| Jars of Clay/ | 2025-01-06 20:33 | - | |
| Jason Mraz/ | 2025-04-01 04:13 | - | |
| Jay Z/ | 2025-04-01 04:13 | - | |
| Jeff Beck/ | 2025-01-06 20:33 | - | |
| Jeff Healey Band/ | 2025-01-06 20:33 | - | |
| Jefferson Airplane/ | 2025-01-06 20:33 | - | |
| Jefferson Starship/ | 2025-04-01 04:13 | - | |
| Jermaine Dupri/ | 2025-04-01 04:13 | - | |
| Jerry Cantrell/ | 2025-01-06 20:33 | - | |
| Jerry Reed/ | 2025-04-01 04:13 | - | |
| Jessica Simpson/ | 2025-01-06 20:33 | - | |
| Jesus Jones/ | 2025-01-06 20:33 | - | |
| Jet/ | 2025-04-01 04:13 | - | |
| Jethro Tull/ | 2025-01-06 20:33 | - | |
| Jewel/ | 2025-01-06 20:33 | - | |
| Jim Croce/ | 2025-01-06 20:33 | - | |
| Jimi Hendrix/ | 2025-04-01 04:13 | - | |
| Jimmy Buffet/ | 2025-04-01 04:13 | - | |
| Jimmy Eat World/ | 2025-01-06 20:33 | - | |
| Jimmy Ray/ | 2025-01-06 20:33 | - | |
| Jimmy Ruffin/ | 2025-01-06 20:33 | - | |
| JoJo/ | 2025-01-06 20:33 | - | |
| Joan Jett and the Blackhearts/ | 2025-04-01 04:13 | - | |
| Joan Osborne/ | 2025-01-06 20:33 | - | |
| Joe Budden/ | 2025-01-06 20:33 | - | |
| Joe Cocker/ | 2025-04-01 04:13 | - | |
| Joe Satriani/ | 2025-01-06 20:33 | - | |
| Joe Walsh - James Gang/ | 2025-04-01 04:13 | - | |
| John Denver/ | 2025-01-06 20:33 | - | |
| John Fogerty/ | 2025-01-06 20:33 | - | |
| John Legend/ | 2025-04-01 04:13 | - | |
| John Lennon/ | 2025-01-06 20:33 | - | |
| John Mayer/ | 2025-04-01 04:13 | - | |
| John Melloncamp/ | 2025-04-01 04:13 | - | |
| John Parr/ | 2025-01-06 20:33 | - | |
| John Waite/ | 2025-01-06 20:33 | - | |
| Johnny Cash/ | 2025-04-01 04:13 | - | |
| Johnny Nash/ | 2025-01-06 20:33 | - | |
| Johnny Rivers/ | 2025-01-06 20:33 | - | |
| Jonathan Edwards/ | 2025-04-01 04:13 | - | |
| Journey/ | 2025-04-01 04:13 | - | |
| Judas Priest/ | 2025-04-01 04:13 | - | |
| Juelz Santana/ | 2025-04-01 04:13 | - | |
| Julian Lennon/ | 2025-04-01 04:13 | - | |
| Jump, Little Children/ | 2025-04-01 04:13 | - | |
| Justin Timberlake/ | 2025-04-01 04:13 | - | |
| Juvenile/ | 2025-01-06 20:33 | - | |
| K-Ci and Jo-Jo/ | 2025-01-06 20:34 | - | |
| KC and the Sunshine Band/ | 2025-04-01 04:13 | - | |
| KISS/ | 2025-04-01 04:13 | - | |
| Kane & Abel/ | 2025-01-06 20:33 | - | |
| Kansas/ | 2025-01-06 20:33 | - | |
| Kanye West/ | 2025-04-01 04:13 | - | |
| Katrina and the Waves/ | 2025-01-06 20:34 | - | |
| Katt Williams/ | 2025-04-01 04:13 | - | |
| Keane/ | 2025-04-01 04:13 | - | |
| Kelis/ | 2025-04-01 04:13 | - | |
| Kelly Clarkson/ | 2025-01-06 20:34 | - | |
| Kenny Loggins/ | 2025-04-01 04:13 | - | |
| Kenny Rogers/ | 2025-04-01 04:13 | - | |
| Kenny Wayne Shepherd/ | 2025-01-06 20:34 | - | |
| Kentucky Headhunters/ | 2025-01-06 20:34 | - | |
| Kevin Lyttle/ | 2025-01-06 20:34 | - | |
| Khia/ | 2025-01-06 20:34 | - | |
| Kid Rock/ | 2025-04-01 04:13 | - | |
| Killers, The/ | 2025-04-01 04:13 | - | |
| Kilo Ali/ | 2025-01-06 20:34 | - | |
| Kingsmen/ | 2025-01-06 20:34 | - | |
| Kings of Leon/ | 2025-04-01 04:13 | - | |
| Kinks, The/ | 2025-01-06 20:34 | - | |
| Kinky/ | 2025-04-01 04:13 | - | |
| Knack, The/ | 2025-01-06 20:34 | - | |
| Kool and the Gang/ | 2025-01-06 20:34 | - | |
| Korn/ | 2025-04-01 04:13 | - | |
| Kottonmouth Kings/ | 2025-04-01 04:13 | - | |
| Kriss Kross/ | 2025-01-06 20:34 | - | |
| Kylie Minogue/ | 2025-01-06 20:34 | - | |
| L7/ | 2025-04-01 04:13 | - | |
| LFO/ | 2025-01-06 20:34 | - | |
| LL Cool J/ | 2025-01-06 20:34 | - | |
| Lacuna Coil/ | 2025-04-01 04:13 | - | |
| Lamb of God/ | 2025-04-01 04:13 | - | |
| Lazyboy/ | 2025-01-06 20:34 | - | |
| Led Zeppelin/ | 2025-04-01 04:13 | - | |
| Lee Michaels/ | 2025-01-06 20:34 | - | |
| Len/ | 2025-01-06 20:34 | - | |
| Lenny Kravitz/ | 2025-01-06 20:34 | - | |
| Letters to Cleo/ | 2025-01-06 20:34 | - | |
| Lifehouse/ | 2025-04-01 04:13 | - | |
| Lil' Jon and The Eastside Boys/ | 2025-04-01 04:13 | - | |
| Lil' Kim/ | 2025-01-06 20:34 | - | |
| Lil' Wayne/ | 2025-04-01 04:13 | - | |
| Lil Boosie/ | 2025-01-06 20:34 | - | |
| Lil Bow Wow/ | 2025-04-01 04:13 | - | |
| Lil Flip/ | 2025-04-01 04:13 | - | |
| Lil Scrappy/ | 2025-01-06 20:34 | - | |
| Lil Wyte/ | 2025-04-03 03:32 | - | |
| Lil Zane/ | 2025-01-06 20:34 | - | |
| Limbeck/ | 2025-01-06 20:34 | - | |
| Limp Bizkit/ | 2025-04-01 04:13 | - | |
| Linkin Park/ | 2025-04-01 04:13 | - | |
| Linkin Park and Jay-Z/ | 2025-04-01 04:13 | - | |
| Lionel Richie/ | 2025-04-01 04:13 | - | |
| Lipps, Inc/ | 2025-01-06 20:34 | - | |
| Lisa Loeb/ | 2025-01-06 20:34 | - | |
| Lit/ | 2025-01-06 20:34 | - | |
| Little Richard/ | 2025-04-01 04:13 | - | |
| Little River Band/ | 2025-01-06 20:34 | - | |
| Little Troy/ | 2025-01-06 20:34 | - | |
| Live/ | 2025-04-01 04:13 | - | |
| Living Colour/ | 2025-01-06 20:34 | - | |
| Living Legends/ | 2025-01-06 20:34 | - | |
| Liz Phair/ | 2025-01-06 20:34 | - | |
| Lloyd Banks/ | 2025-01-06 20:34 | - | |
| Local H/ | 2025-04-01 04:13 | - | |
| Looper/ | 2025-04-01 04:13 | - | |
| Lord Tariq and Peter Gunz/ | 2025-01-06 20:34 | - | |
| Los Lonely Boys/ | 2025-01-06 20:34 | - | |
| Lostprophets/ | 2025-04-01 04:13 | - | |
| Lou Reed/ | 2025-01-06 20:34 | - | |
| Loverboy/ | 2025-04-01 04:13 | - | |
| Lovin' Spoonful/ | 2025-01-06 20:34 | - | |
| Ludacris/ | 2025-04-01 04:13 | - | |
| Lynyrd Skynyrd/ | 2025-04-01 04:13 | - | |
| MC 900/ | 2025-01-06 20:34 | - | |
| MC Hammer/ | 2025-01-06 20:34 | - | |
| MXPX/ | 2025-01-06 20:34 | - | |
| Ma$e/ | 2025-04-01 04:13 | - | |
| Mac Lethal/ | 2025-04-01 04:13 | - | |
| Machine Head/ | 2025-04-01 04:13 | - | |
| Mack 10/ | 2025-01-06 20:34 | - | |
| Mad Season/ | 2025-01-06 20:34 | - | |
| Madonna/ | 2025-04-01 04:13 | - | |
| Mandy Moore/ | 2025-04-01 04:13 | - | |
| Manfred Mann/ | 2025-01-06 20:34 | - | |
| Manny Fresh/ | 2025-04-01 04:13 | - | |
| Marc Cohn/ | 2025-04-01 04:13 | - | |
| Marcato/ | 2025-01-06 20:34 | - | |
| Marcy Playground/ | 2025-01-06 20:34 | - | |
| Mariah Carey/ | 2025-04-01 04:13 | - | |
| Marilyn Manson/ | 2025-04-01 04:13 | - | |
| Maroon5/ | 2025-04-01 04:13 | - | |
| Mars Volta, The/ | 2025-01-06 20:34 | - | |
| Marshall Tucker Band/ | 2025-04-01 04:13 | - | |
| Marvin Gaye/ | 2025-01-06 20:34 | - | |
| Mason Jennings/ | 2025-01-06 20:34 | - | |
| Master P/ | 2025-01-06 20:34 | - | |
| Matchbox 20/ | 2025-04-01 04:13 | - | |
| Matthew Wilder/ | 2025-04-01 04:13 | - | |
| Mazzy Star/ | 2025-01-06 20:34 | - | |
| Mclusky/ | 2025-04-01 04:13 | - | |
| Meatloaf/ | 2025-01-06 20:34 | - | |
| Megadeth/ | 2025-04-01 04:13 | - | |
| Memphis Bleek/ | 2025-04-01 04:13 | - | |
| Men at Work/ | 2025-04-01 04:13 | - | |
| Meredith Brooks/ | 2025-01-06 20:34 | - | |
| Merle Haggard/ | 2025-01-06 20:34 | - | |
| Merril Bainbridge/ | 2025-04-01 04:13 | - | |
| Metallica/ | 2025-04-01 04:13 | - | |
| Method Man and Redman/ | 2025-04-01 04:13 | - | |
| Methods of Mayhem/ | 2025-01-06 20:34 | - | |
| Miami Sound Machine/ | 2025-01-06 20:34 | - | |
| Michael Jackson/ | 2025-04-01 04:13 | - | |
| Michelle Branch/ | 2025-01-06 20:34 | - | |
| Mighty Mighty Bosstones, The/ | 2025-01-06 20:34 | - | |
| Mike Myers/ | 2025-01-06 20:34 | - | |
| Mike and The Mechanics/ | 2025-01-06 20:34 | - | |
| Mindless Self Indulgence/ | 2025-04-01 04:13 | - | |
| Ministry of Sound/ | 2025-01-06 20:34 | - | |
| Missy Elliot/ | 2025-01-06 20:34 | - | |
| Moby/ | 2025-04-01 04:13 | - | |
| Modern English/ | 2025-01-06 20:34 | - | |
| Modest Mouse/ | 2025-04-01 04:13 | - | |
| Molly Hatchet/ | 2025-04-01 04:13 | - | |
| Monkees, The/ | 2025-01-06 20:34 | - | |
| Monster Magnet/ | 2025-01-06 20:34 | - | |
| Montell Jordan/ | 2025-01-06 20:34 | - | |
| Monty Norman Orchestra/ | 2025-04-01 04:13 | - | |
| Moody Blues, The/ | 2025-01-06 20:34 | - | |
| Motley Crue/ | 2025-04-01 04:13 | - | |
| Motorhead/ | 2025-04-01 04:13 | - | |
| Moulin Rouge Soundtrack/ | 2025-01-06 20:34 | - | |
| Mr. Big/ | 2025-01-06 20:34 | - | |
| Mr. Magic/ | 2025-01-06 20:34 | - | |
| Mr. Mister/ | 2025-01-06 20:34 | - | |
| Mudvayne/ | 2025-04-01 04:13 | - | |
| Mungo Jerry/ | 2025-04-01 04:13 | - | |
| Murderdolls/ | 2025-01-06 20:34 | - | |
| Murphy Lee/ | 2025-01-06 20:34 | - | |
| Muse/ | 2025-04-01 04:13 | - | |
| My Chemical Romance/ | 2025-04-01 04:13 | - | |
| Mya/ | 2025-01-06 20:34 | - | |
| Mystikal/ | 2025-04-01 04:13 | - | |
| N.E.R.D/ | 2025-04-01 04:13 | - | |
| N.W.A/ | 2025-01-06 20:34 | - | |
| NRBQ/ | 2025-01-06 20:34 | - | |
| Naked Eyes/ | 2025-01-06 20:34 | - | |
| Nancy Sinatra/ | 2025-04-01 04:13 | - | |
| Nappy Roots/ | 2025-04-03 03:32 | - | |
| Nas/ | 2025-04-01 04:13 | - | |
| Natalie Imbruglia/ | 2025-01-06 20:34 | - | |
| Natalie Merchant/ | 2025-01-06 20:34 | - | |
| Naughty By Nature/ | 2025-01-06 20:34 | - | |
| Nazareth/ | 2025-01-06 20:34 | - | |
| Ne-Yo/ | 2025-04-01 04:13 | - | |
| Neil Diamond/ | 2025-04-01 04:13 | - | |
| Neil Young/ | 2025-04-01 04:13 | - | |
| Nelly/ | 2025-04-01 04:13 | - | |
| Nelly Furtado/ | 2025-04-01 04:13 | - | |
| New Kids On The Block/ | 2025-01-06 20:34 | - | |
| New Radicals/ | 2025-04-01 04:13 | - | |
| Newcleus/ | 2025-01-06 20:34 | - | |
| Nickelback/ | 2025-04-01 04:13 | - | |
| Night Ranger/ | 2025-01-06 20:34 | - | |
| Nina Sky/ | 2025-01-06 20:34 | - | |
| Nine Days/ | 2025-01-06 20:34 | - | |
| Nine Inch Nails/ | 2025-04-01 04:13 | - | |
| Nirvana/ | 2025-04-01 04:13 | - | |
| Nitty Gritty Dirt Band/ | 2025-01-06 20:34 | - | |
| No Address/ | 2025-04-01 04:13 | - | |
| No Doubt/ | 2025-04-01 04:13 | - | |
| Nonpoint/ | 2025-04-01 04:13 | - | |
| Notorious B.I.G/ | 2025-04-01 04:13 | - | |
| O'Jays, The/ | 2025-01-06 20:34 | - | |
| ODB - Old Dirty Bastard/ | 2025-01-06 20:34 | - | |
| OK Go/ | 2025-04-01 04:13 | - | |
| OMC/ | 2025-01-06 20:34 | - | |
| Oasis/ | 2025-04-01 04:13 | - | |
| Obie Trice/ | 2025-04-01 04:13 | - | |
| Office Space Soundtrack/ | 2025-01-06 20:34 | - | |
| Offspring, The/ | 2025-04-01 04:13 | - | |
| Old Crow Medicine Show/ | 2025-04-01 04:13 | - | |
| Oldies/ | 2025-04-01 04:13 | - | |
| One Day as a Lion/ | 2025-04-01 04:13 | - | |
| Onyx/ | 2025-01-06 20:34 | - | |
| Orff/ | 2025-01-06 20:34 | - | |
| Organic Audio/ | 2025-01-06 20:34 | - | |
| Orgy/ | 2025-01-06 20:34 | - | |
| Our Lady Peace/ | 2025-04-01 04:13 | - | |
| Outfield/ | 2025-01-06 20:34 | - | |
| Outkast/ | 2025-04-01 04:13 | - | |
| Outlaws, The/ | 2025-04-01 04:13 | - | |
| Owl City/ | 2025-04-01 04:13 | - | |
| Oysterhead/ | 2025-04-01 04:13 | - | |
| Ozzy Osbourne/ | 2025-04-01 04:13 | - | |
| P$C/ | 2025-04-01 04:13 | - | |
| P. Diddy/ | 2025-01-06 20:34 | - | |
| POD/ | 2025-04-01 04:13 | - | |
| Pantera/ | 2025-04-01 04:13 | - | |
| Papa Roach/ | 2025-04-01 04:13 | - | |
| Partners in Kryme/ | 2025-01-06 20:34 | - | |
| Pastor Troy/ | 2025-04-01 04:13 | - | |
| Pat Benetar/ | 2025-01-06 20:34 | - | |
| Paul McCartney & Wings/ | 2025-01-06 20:34 | - | |
| Paul Oakenfold/ | 2025-04-01 04:13 | - | |
| Paul Simon/ | 2025-01-06 20:34 | - | |
| Paul Wall/ | 2025-04-01 04:13 | - | |
| Paula Abdul/ | 2025-04-01 04:13 | - | |
| Pearl Jam/ | 2025-04-01 04:13 | - | |
| Pepper/ | 2025-04-03 03:32 | - | |
| Peter Frampton/ | 2025-04-01 04:13 | - | |
| Peter Gabriel/ | 2025-04-01 04:13 | - | |
| Petey Pablo/ | 2025-01-06 20:34 | - | |
| Petula Clark/ | 2025-01-06 20:34 | - | |
| Phil Collins/ | 2025-04-01 04:13 | - | |
| Philander/ | 2025-01-06 20:34 | - | |
| Phish/ | 2025-04-01 04:13 | - | |
| Piebald/ | 2025-04-01 04:13 | - | |
| Pilot/ | 2025-01-06 20:34 | - | |
| Pink/ | 2025-04-01 04:13 | - | |
| Pink Floyd/ | 2025-04-01 04:13 | - | |
| Pitbull/ | 2025-04-01 04:13 | - | |
| Pixies, The/ | 2025-01-06 20:34 | - | |
| Plain White T's/ | 2025-04-01 04:13 | - | |
| Plies/ | 2025-01-06 20:34 | - | |
| Pointer Sisters/ | 2025-04-01 04:13 | - | |
| Poison/ | 2025-04-01 04:13 | - | |
| Police, The/ | 2025-01-06 20:35 | - | |
| Powerman 5000/ | 2025-04-03 03:32 | - | |
| Powerstation/ | 2025-04-01 04:13 | - | |
| Pras/ | 2025-01-06 20:35 | - | |
| Presidents of the United States of America/ | 2025-01-06 20:35 | - | |
| Pretenders, The/ | 2025-04-01 04:13 | - | |
| Pretty Ricky/ | 2025-04-01 04:13 | - | |
| Pretty Willie/ | 2025-01-06 20:35 | - | |
| Priestess/ | 2025-04-01 04:13 | - | |
| Primer 55/ | 2025-01-06 20:35 | - | |
| Primus/ | 2025-04-01 04:13 | - | |
| Prince/ | 2025-04-01 04:13 | - | |
| Probot/ | 2025-04-01 04:13 | - | |
| Proclaimers, The/ | 2025-01-06 20:35 | - | |
| Prodigy/ | 2025-04-01 04:13 | - | |
| Prof/ | 2025-02-14 05:36 | - | |
| Project Pat/ | 2025-01-06 20:35 | - | |
| Puddle of Mudd/ | 2025-04-01 04:13 | - | |
| Puff Daddy and the Family/ | 2025-04-01 04:13 | - | |
| Pulp Fiction Soundtrack/ | 2025-01-06 20:35 | - | |
| Pussycat Dolls, The/ | 2025-04-01 04:13 | - | |
| Quarashi/ | 2025-01-06 20:35 | - | |
| Queen/ | 2025-01-06 20:35 | - | |
| Queens of the Stone Age/ | 2025-04-03 03:32 | - | |
| Quiet Riot/ | 2025-04-01 04:13 | - | |
| R. Kelly/ | 2025-04-01 04:13 | - | |
| REM/ | 2025-04-01 04:13 | - | |
| REO Speedwagon/ | 2025-04-01 04:13 | - | |
| Ra/ | 2025-04-01 04:13 | - | |
| Radiohead/ | 2025-04-01 04:13 | - | |
| Rage Against the Machine/ | 2025-04-01 04:13 | - | |
| Ram Jam/ | 2025-01-06 20:35 | - | |
| Rammstein/ | 2025-04-01 04:13 | - | |
| Rare Earth/ | 2025-01-06 20:35 | - | |
| Ratt/ | 2025-04-01 04:13 | - | |
| Ravyns/ | 2025-01-06 20:35 | - | |
| Ray Orbison/ | 2025-01-06 20:35 | - | |
| Red Hot Chili Peppers/ | 2025-04-01 04:13 | - | |
| Rembrandts, The/ | 2025-01-06 20:35 | - | |
| Remember the Titans Soundrack/ | 2025-04-01 04:13 | - | |
| Republica/ | 2025-04-01 04:13 | - | |
| Reverend Horton Heat/ | 2025-01-06 20:35 | - | |
| Rhino Bucket/ | 2025-01-06 20:35 | - | |
| Ric Jilla/ | 2025-01-06 20:35 | - | |
| Richie Valens/ | 2025-01-06 20:35 | - | |
| Rick Astley/ | 2025-01-06 20:35 | - | |
| Rick Derringer/ | 2025-01-06 20:35 | - | |
| Rick James/ | 2025-01-06 20:35 | - | |
| Rick Ross/ | 2025-04-01 04:13 | - | |
| Rick Springfield/ | 2025-01-06 20:35 | - | |
| Righteous Brothers, The/ | 2025-01-06 20:35 | - | |
| Rise Against/ | 2025-04-01 04:13 | - | |
| Rob Zombie/ | 2025-04-01 04:13 | - | |
| Robbie Williams/ | 2025-01-06 20:35 | - | |
| Robert Palmer/ | 2025-04-01 04:13 | - | |
| Robin Thicke/ | 2025-04-01 04:13 | - | |
| Rod Stewart/ | 2025-04-01 04:13 | - | |
| Rodney Crowell/ | 2025-01-06 20:35 | - | |
| Rolling Stones, The/ | 2025-04-01 04:13 | - | |
| Roxette/ | 2025-04-01 04:13 | - | |
| Roy Orbison/ | 2025-01-06 20:35 | - | |
| Royce Da 5-9/ | 2025-01-06 20:35 | - | |
| Rufus Wainwright/ | 2025-01-06 20:35 | - | |
| Run DMC/ | 2025-01-06 20:35 | - | |
| Rupert Holmes/ | 2025-04-01 04:13 | - | |
| Rush/ | 2025-04-01 04:13 | - | |
| SUM41/ | 2025-04-01 04:13 | - | |
| Sage Francis/ | 2025-01-06 20:35 | - | |
| Saliva/ | 2025-04-01 04:13 | - | |
| Salt 'n Peppa/ | 2025-01-06 20:35 | - | |
| Sam Cooke/ | 2025-01-06 20:35 | - | |
| Sam and Dave/ | 2025-01-06 20:35 | - | |
| Sammy Hagar/ | 2025-04-01 04:13 | - | |
| Santana-Guitar_Heaven_The_Greatest_Guitar_Classics_Of_All_Time-2010-DOH/ | 2025-04-01 04:12 | - | |
| Sara Barielles/ | 2025-04-01 04:13 | - | |
| Savage Garden/ | 2025-04-01 04:13 | - | |
| Save Ferris/ | 2025-01-06 20:35 | - | |
| Saving Abel/ | 2025-04-01 04:13 | - | |
| Say Yes/ | 2025-01-06 20:35 | - | |
| Scarface/ | 2025-04-01 04:13 | - | |
| Scorpions, The/ | 2025-04-01 04:13 | - | |
| Scott McKenzie/ | 2025-01-06 20:35 | - | |
| Sean Paul/ | 2025-04-01 04:13 | - | |
| Seether/ | 2025-04-01 04:13 | - | |
| Selena/ | 2025-01-06 20:35 | - | |
| Semisonic/ | 2025-01-06 20:35 | - | |
| Sergio Mendes/ | 2025-04-01 04:13 | - | |
| Serj Tankian/ | 2025-04-01 04:13 | - | |
| Seven Mary Three/ | 2025-01-06 20:35 | - | |
| Sevendust/ | 2025-04-01 04:13 | - | |
| Sex Pistols, The/ | 2025-04-01 04:13 | - | |
| Shadows Fall/ | 2025-04-01 04:13 | - | |
| Shaggy/ | 2025-04-01 04:13 | - | |
| Shakin Stevens/ | 2025-04-01 04:13 | - | |
| Shakira/ | 2025-04-01 04:13 | - | |
| Shawn Anthony/ | 2025-01-06 20:35 | - | |
| Shawn Colvin/ | 2025-01-06 20:35 | - | |
| Sheriff/ | 2025-04-01 04:13 | - | |
| Sheryl Crow/ | 2025-04-01 04:13 | - | |
| Shinedown/ | 2025-04-01 04:13 | - | |
| Shins, The/ | 2025-04-01 04:13 | - | |
| Shyne/ | 2025-04-01 04:13 | - | |
| Silverchair/ | 2025-04-01 04:13 | - | |
| Silvertide/ | 2025-01-06 20:35 | - | |
| Simon and Garfunkle/ | 2025-01-06 20:35 | - | |
| Simple Minds/ | 2025-01-06 20:35 | - | |
| Simply Red/ | 2025-01-06 20:35 | - | |
| Sinead O'Connor/ | 2025-01-06 20:35 | - | |
| Sir Mix-A-Lot/ | 2025-04-01 04:13 | - | |
| Sisqo/ | 2025-01-06 20:35 | - | |
| Sister Hazel/ | 2025-01-06 20:35 | - | |
| Sixpence None The Richer/ | 2025-04-01 04:13 | - | |
| Sixx AM/ | 2025-01-06 20:35 | - | |
| Skee Lo/ | 2025-01-06 20:35 | - | |
| Skid Row/ | 2025-04-01 04:13 | - | |
| Skindred/ | 2025-04-01 04:13 | - | |
| Skrape/ | 2025-04-01 04:13 | - | |
| Slaughter/ | 2025-04-01 04:13 | - | |
| Slick Rick/ | 2025-01-06 20:35 | - | |
| Slim Thug/ | 2025-01-06 20:35 | - | |
| Slipknot/ | 2025-04-01 04:13 | - | |
| Smash Mouth/ | 2025-04-01 04:13 | - | |
| Smashing Pumpkins, The/ | 2025-04-01 04:13 | - | |
| Smile Empty Soul/ | 2025-04-01 04:13 | - | |
| Smilez and Southstar/ | 2025-04-01 04:13 | - | |
| Snap/ | 2025-01-06 20:35 | - | |
| Sno/ | 2025-01-06 20:35 | - | |
| Snoop Dogg/ | 2025-04-01 04:13 | - | |
| Social Distortion/ | 2025-01-06 20:35 | - | |
| Soft Cell/ | 2025-01-06 20:35 | - | |
| Something Corporate/ | 2025-04-01 04:13 | - | |
| Sonique/ | 2025-04-01 04:13 | - | |
| Sonny and Cher/ | 2025-01-06 20:35 | - | |
| Sophie B. Hawkins/ | 2025-04-01 04:13 | - | |
| Soul Asylum/ | 2025-04-01 04:13 | - | |
| Soul Coughing/ | 2025-04-01 04:13 | - | |
| Soundgarden/ | 2025-04-01 04:13 | - | |
| Southern Culture on the Skids/ | 2025-04-03 03:32 | - | |
| Spacehog/ | 2025-01-06 20:35 | - | |
| Spandau Ballet/ | 2025-04-01 04:13 | - | |
| Spencer Davis Group/ | 2025-04-01 04:13 | - | |
| Spiderbait/ | 2025-01-06 20:35 | - | |
| Spin Doctors/ | 2025-04-01 04:13 | - | |
| Spineshank/ | 2025-01-06 20:35 | - | |
| Spoon/ | 2025-04-03 03:32 | - | |
| Spunkadelic/ | 2025-04-01 04:13 | - | |
| Squeeze/ | 2025-01-06 20:35 | - | |
| Squirrel Nut Zippers/ | 2025-01-06 20:35 | - | |
| Stabbing Westward/ | 2025-04-01 04:13 | - | |
| Staind/ | 2025-04-01 04:13 | - | |
| Starland Vocal Band/ | 2025-04-01 04:13 | - | |
| Steel Dragon/ | 2025-01-06 20:35 | - | |
| Steelers Wheel/ | 2025-01-06 20:35 | - | |
| Steely Dan/ | 2025-04-01 04:13 | - | |
| Steppenwolf/ | 2025-01-06 20:35 | - | |
| Steve Miller Band/ | 2025-01-06 20:35 | - | |
| Steve Vai/ | 2025-04-01 04:13 | - | |
| Steve Winwood/ | 2025-04-01 04:13 | - | |
| Stevie Nicks/ | 2025-04-01 04:12 | - | |
| Stevie Ray Vaughn/ | 2025-04-16 06:17 | - | |
| Stevie Wonder/ | 2025-01-06 20:35 | - | |
| Sting/ | 2025-01-06 20:35 | - | |
| Stone Sour/ | 2025-04-01 04:13 | - | |
| Stone Temple Pilots/ | 2025-04-01 04:13 | - | |
| Story of the Year/ | 2025-04-01 04:13 | - | |
| Strawberry Alarm Clock/ | 2025-01-06 20:35 | - | |
| Straylight Run/ | 2025-01-06 20:35 | - | |
| Streets of Fire/ | 2025-01-06 20:35 | - | |
| Stroke 9/ | 2025-04-01 04:13 | - | |
| Strokes, The/ | 2025-04-01 04:13 | - | |
| Styx/ | 2025-01-06 20:35 | - | |
| Sublime/ | 2025-01-06 20:35 | - | |
| Sugar Ray/ | 2025-01-06 20:35 | - | |
| Sugarbomb/ | 2025-04-01 04:13 | - | |
| Sugarcult/ | 2025-01-06 20:35 | - | |
| Sugarhill Gang/ | 2025-01-06 20:35 | - | |
| Supertramp/ | 2025-04-01 04:13 | - | |
| Swing Out Sister/ | 2025-04-01 04:13 | - | |
| Swirl 360/ | 2025-01-06 20:35 | - | |
| Switchfoot/ | 2025-04-01 04:13 | - | |
| Sword, The/ | 2025-04-01 04:13 | - | |
| System of a Down/ | 2025-04-01 04:13 | - | |
| T.I/ | 2025-04-01 04:13 | - | |
| TLC/ | 2025-01-06 20:35 | - | |
| T Pain/ | 2025-01-06 20:35 | - | |
| TQ/ | 2025-01-06 20:35 | - | |
| TRU/ | 2025-04-01 04:13 | - | |
| T Rex/ | 2025-04-01 04:13 | - | |
| Taco/ | 2025-04-01 04:13 | - | |
| Tag Team/ | 2025-01-06 20:35 | - | |
| Taking Back Sunday/ | 2025-04-01 04:13 | - | |
| Tal Bachman/ | 2025-01-06 20:35 | - | |
| Talking Heads/ | 2025-04-01 04:13 | - | |
| Tantric/ | 2025-04-01 04:13 | - | |
| Taproot/ | 2025-04-01 04:13 | - | |
| Tatu/ | 2025-01-06 20:35 | - | |
| Tears For Fears/ | 2025-01-06 20:35 | - | |
| Tech n9ne/ | 2025-04-01 04:13 | - | |
| Technotronic/ | 2025-01-06 20:35 | - | |
| Ted Nugent/ | 2025-01-06 20:35 | - | |
| Temple of the Dog/ | 2025-01-06 20:35 | - | |
| Temptations, The/ | 2025-01-06 20:35 | - | |
| Ten Years After/ | 2025-01-06 20:35 | - | |
| Tenacious D/ | 2025-04-01 04:13 | - | |
| Terror Squad/ | 2025-04-01 04:13 | - | |
| Terry Reid/ | 2025-04-01 04:13 | - | |
| Tesla/ | 2025-04-01 04:13 | - | |
| Thalia/ | 2025-01-06 20:35 | - | |
| That Handsome Devil/ | 2025-04-01 04:13 | - | |
| The Fast and The Furious Score/ | 2025-01-06 20:35 | - | |
| The Fast and the Furious Soundtrack/ | 2025-04-01 04:13 | - | |
| The Matrix Soundtrack/ | 2025-04-01 04:13 | - | |
| The Pledge Of Allegiance Tour/ | 2025-01-06 20:35 | - | |
| Themes/ | 2025-01-06 20:35 | - | |
| Theory of a Deadman/ | 2025-04-01 04:13 | - | |
| They Might Be Giants/ | 2025-01-06 20:35 | - | |
| Thin Lizzy/ | 2025-01-06 20:35 | - | |
| Third Eye Blind/ | 2025-04-01 04:13 | - | |
| Thomas Dolby/ | 2025-01-06 20:35 | - | |
| Thompson Twins/ | 2025-04-01 04:13 | - | |
| Thornley/ | 2025-04-01 04:13 | - | |
| Thousand Foot Krutch/ | 2025-01-06 20:35 | - | |
| Three 6 Mafia/ | 2025-04-01 04:13 | - | |
| Three Days Grace/ | 2025-04-01 04:13 | - | |
| Three Dog Night/ | 2025-04-01 04:13 | - | |
| Thrice/ | 2025-04-01 04:13 | - | |
| Thunderclap Newman/ | 2025-01-06 20:35 | - | |
| Thursday/ | 2025-04-01 04:13 | - | |
| Tia Carerre/ | 2025-01-06 20:35 | - | |
| Tiffany/ | 2025-01-06 20:35 | - | |
| Timbaland/ | 2025-01-06 20:35 | - | |
| Timbuk3/ | 2025-01-06 20:35 | - | |
| Toadies, The/ | 2025-01-06 20:35 | - | |
| Toad the Wet Sprocket/ | 2025-04-01 04:13 | - | |
| Tocka/ | 2025-01-06 20:35 | - | |
| Todd Rundgren/ | 2025-04-01 04:13 | - | |
| Tom Cochrane/ | 2025-01-06 20:35 | - | |
| Tom Green/ | 2025-01-06 20:35 | - | |
| Tom Petty/ | 2025-04-01 04:13 | - | |
| Tommy James and The Shondells/ | 2025-04-01 04:13 | - | |
| Tommy Lee/ | 2025-04-01 04:13 | - | |
| Tommy Tutone/ | 2025-01-06 20:35 | - | |
| Tomorrow Never Dies Soundtrack/ | 2025-01-06 20:35 | - | |
| Tone Loc/ | 2025-01-06 20:35 | - | |
| Tonic/ | 2025-04-01 04:13 | - | |
| Tony Basil/ | 2025-01-06 20:35 | - | |
| Too Short/ | 2025-04-01 04:13 | - | |
| Tool/ | 2025-04-01 04:13 | - | |
| Top Gun Soundtrack/ | 2025-01-06 20:35 | - | |
| Toploader/ | 2025-01-06 20:35 | - | |
| Toto/ | 2025-01-06 20:35 | - | |
| Toya/ | 2025-01-06 20:35 | - | |
| Traffic/ | 2025-01-06 20:35 | - | |
| Train/ | 2025-01-06 20:35 | - | |
| Trapt/ | 2025-04-01 04:13 | - | |
| Traveling Wilbury's, The/ | 2025-04-01 04:13 | - | |
| Travis/ | 2025-01-06 20:35 | - | |
| Trick Daddy/ | 2025-04-01 04:13 | - | |
| Trina/ | 2025-04-01 04:12 | - | |
| Trio/ | 2025-01-06 20:35 | - | |
| Troggs, The/ | 2025-01-06 20:35 | - | |
| Trust Company/ | 2025-01-06 20:35 | - | |
| Tupac/ | 2025-04-01 04:13 | - | |
| Turtles, The/ | 2025-01-06 20:35 | - | |
| Tweet/ | 2025-01-06 20:35 | - | |
| Twenty-Twos, The/ | 2025-04-01 04:13 | - | |
| Twista/ | 2025-04-01 04:13 | - | |
| Twisted Sister/ | 2025-01-06 20:35 | - | |
| Two Gallants/ | 2025-04-01 04:13 | - | |
| U2/ | 2025-04-01 04:13 | - | |
| UB40/ | 2025-01-06 20:35 | - | |
| UGK/ | 2025-01-06 20:35 | - | |
| US3/ | 2025-01-06 20:35 | - | |
| Ugly Kid Joe/ | 2025-01-06 20:35 | - | |
| Uncle Kracker/ | 2025-04-01 04:13 | - | |
| Unloco/ | 2025-01-06 20:35 | - | |
| Unwritten Law/ | 2025-04-01 04:13 | - | |
| Used, The/ | 2025-04-01 04:13 | - | |
| Usher/ | 2025-04-01 04:13 | - | |
| Vampire Weekend/ | 2025-04-01 04:13 | - | |
| Van Halen/ | 2025-04-01 04:13 | - | |
| Vanessa Carlton/ | 2025-01-06 20:36 | - | |
| Vanessa Williams/ | 2025-01-06 20:36 | - | |
| Vangelis/ | 2025-04-01 04:13 | - | |
| Vanilla Ice/ | 2025-04-01 04:13 | - | |
| Vanity Fair/ | 2025-01-06 20:36 | - | |
| Vapors, The/ | 2025-01-06 20:36 | - | |
| Velvet Revolver/ | 2025-04-01 04:13 | - | |
| Verruca Salt/ | 2025-01-06 20:36 | - | |
| Vertical Horizon/ | 2025-01-06 20:36 | - | |
| Verve, The/ | 2025-01-06 20:36 | - | |
| Verve Pipe/ | 2025-01-06 20:36 | - | |
| Village People/ | 2025-01-06 20:36 | - | |
| Vines, The/ | 2025-04-01 04:13 | - | |
| Violent Femmes/ | 2025-01-06 20:36 | - | |
| Vitamin C/ | 2025-01-06 20:36 | - | |
| Wallflowers/ | 2025-04-01 04:13 | - | |
| Wall of Voodoo/ | 2025-04-01 04:12 | - | |
| Wang Chung/ | 2025-01-06 20:36 | - | |
| War/ | 2025-01-06 20:36 | - | |
| Warrant/ | 2025-01-06 20:36 | - | |
| Warren G/ | 2025-01-06 20:36 | - | |
| Warron Zevon/ | 2025-01-06 20:36 | - | |
| Was/ | 2025-01-06 20:36 | - | |
| Wax/ | 2025-01-06 20:36 | - | |
| Wayne Wonder/ | 2025-01-06 20:36 | - | |
| Weezer/ | 2025-04-01 04:13 | - | |
| Westside Connection/ | 2025-04-03 03:32 | - | |
| Wham!/ | 2025-01-06 20:36 | - | |
| White Boy/ | 2025-04-01 04:13 | - | |
| White Snake/ | 2025-04-01 04:13 | - | |
| White Stripes, The/ | 2025-01-06 20:36 | - | |
| White Zombie/ | 2025-04-01 04:13 | - | |
| Whitney Houston/ | 2025-01-06 20:36 | - | |
| Who, The/ | 2025-04-01 04:13 | - | |
| Will.i.am/ | 2025-04-01 04:13 | - | |
| Will Smith/ | 2025-04-01 04:13 | - | |
| Willa Ford/ | 2025-01-06 20:36 | - | |
| Willie Nelson/ | 2025-04-01 04:13 | - | |
| Wilson Phillips/ | 2025-01-06 20:36 | - | |
| Wilson Pickett/ | 2025-04-01 04:13 | - | |
| Winger/ | 2025-01-06 20:36 | - | |
| Wiseguys, The/ | 2025-01-06 20:36 | - | |
| Wolfmother/ | 2025-04-03 03:32 | - | |
| Wombats, The/ | 2025-01-06 20:36 | - | |
| Wrecks-N-Effect/ | 2025-01-06 20:36 | - | |
| Wu Tang Clan/ | 2025-01-06 20:36 | - | |
| Wylde Bunch/ | 2025-01-06 20:36 | - | |
| X-Ecutioners, The/ | 2025-01-06 20:36 | - | |
| Xzbit/ | 2025-04-01 04:13 | - | |
| Yellowcard/ | 2025-04-01 04:13 | - | |
| Yes/ | 2025-01-06 20:36 | - | |
| Yin Yang Twins/ | 2025-01-06 20:36 | - | |
| Young Buck/ | 2025-04-01 04:13 | - | |
| Young Jeezy/ | 2025-04-01 04:13 | - | |
| Young MC/ | 2025-01-06 20:36 | - | |
| Young Rascals/ | 2025-04-01 04:13 | - | |
| Yvonne Elliman/ | 2025-04-01 04:13 | - | |
| ZZ Top/ | 2025-04-01 04:13 | - | |
| Zapp and Roger/ | 2025-01-06 20:36 | - | |
| Zero 7/ | 2025-04-01 04:13 | - | |
| Zion I/ | 2025-04-01 04:13 | - | |
| Zombie Nation/ | 2025-01-06 20:36 | - | |
| Zombies, The/ | 2025-04-01 04:13 | - | |
| Zwan/ | 2025-01-06 20:36 | - | |
| easteighteen/ | 2025-01-06 20:33 | - | |
|
|---|