![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Paul (skit).mp3 | 2025-01-30 20:23 | 383K | |
| Public Service Announcement 2000.mp3 | 2025-01-30 20:23 | 723K | |
| Steve Berman.mp3 | 2025-01-30 20:23 | 1.4M | |
| Ken Kaniff (skit).mp3 | 2025-01-30 20:23 | 1.5M | |
| Remember Me-.mp3 | 2025-01-30 20:23 | 5.1M | |
| Who Knew.mp3 | 2025-01-30 20:23 | 5.3M | |
| Amityville.mp3 | 2025-01-30 20:23 | 6.0M | |
| Kill You.mp3 | 2025-01-30 20:23 | 6.2M | |
| The Real Slim Shady.mp3 | 2025-01-30 20:23 | 6.6M | |
| Bitch Please II.mp3 | 2025-01-30 20:23 | 6.7M | |
| The Way I Am.mp3 | 2025-01-30 20:23 | 6.8M | |
| Drug Ballad.mp3 | 2025-01-30 20:23 | 7.0M | |
| I'm Back.mp3 | 2025-01-30 20:23 | 7.2M | |
| Criminal.mp3 | 2025-01-30 20:23 | 7.4M | |
| Marshall Mathers.mp3 | 2025-01-30 20:23 | 7.5M | |
| Under The Influence.mp3 | 2025-01-30 20:23 | 7.5M | |
| Kim.mp3 | 2025-01-30 20:23 | 8.8M | |
| Stan.mp3 | 2025-01-30 20:23 | 9.4M | |